C32H36F3N5O4 — CID 46946566
1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]propan-1-one (PubChem CID 46946566) has the molecular formula C32H36F3N5O4 and a molecular weight of 611.67 g/mol. Its IUPAC name is 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 46946566 |
| Molecular Formula | C32H36F3N5O4 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-phenylmethoxyphenyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCN1CCN(c2ccc(OCc3ccccc3)cc2)CC1)N1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C32H36F3N5O4/c33-32(34,35)29-22-26(6-11-30(29)40(42)43)36-25-12-16-39(17-13-25)31(41)14-15-37-18-20-38(21-19-37)27-7-9-28(10-8-27)44-23-24-4-2-1-3-5-24/h1-11,22,25,36H,12-21,23H2 |
| InChIKey | JXLPAWIXEAVBMG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|