C33H38F3N5O5 — CID 58576847
1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one (PubChem CID 58576847) has the molecular formula C33H38F3N5O5 and a molecular weight of 641.69 g/mol. Its IUPAC name is 1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576847 |
| Molecular Formula | C33H38F3N5O5 |
| Molecular Weight | 641.69 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]piperazin-1-yl]propan-1-one |
| SMILES | COc1cc(NC2CCN(C(=O)CCN3CCN(c4ccc(OCc5ccc(C(F)(F)F)cc5)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H38F3N5O5/c1-45-31-22-27(6-11-30(31)41(43)44)37-26-12-16-40(17-13-26)32(42)14-15-38-18-20-39(21-19-38)28-7-9-29(10-8-28)46-23-24-2-4-25(5-3-24)33(34,35)36/h2-11,22,26,37H,12-21,23H2,1H3 |
| InChIKey | BGFIOBDKJUGJKG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 100.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|