C29H42N4O5 — CID 157195095
methane;1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[(4-methylphenyl)methoxy]piperidin-1-yl]propan-1-one (PubChem CID 157195095) has the molecular formula C29H42N4O5 and a molecular weight of 526.68 g/mol. Its IUPAC name is methane;1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[(4-methylphenyl)methoxy]piperidin-1-yl]propan-1-one.
| Compound Name | methane;1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[(4-methylphenyl)methoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 157195095 |
| Molecular Formula | C29H42N4O5 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.32 |
| IUPAC Name | methane;1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[(4-methylphenyl)methoxy]piperidin-1-yl]propan-1-one |
| SMILES | C.COc1cc(NC2CCN(C(=O)CCN3CCC(OCc4ccc(C)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H38N4O5.CH4/c1-21-3-5-22(6-4-21)20-37-25-11-14-30(15-12-25)16-13-28(33)31-17-9-23(10-18-31)29-24-7-8-26(32(34)35)27(19-24)36-2;/h3-8,19,23,25,29H,9-18,20H2,1-2H3;1H4 |
| InChIKey | AQDOYBVEMCTPHQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|