C26H33ClN4O4 — CID 58577234
3-[4-(4-chlorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]propan-1-one (PubChem CID 58577234) has the molecular formula C26H33ClN4O4 and a molecular weight of 501.03 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(4-chlorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58577234 |
| Molecular Formula | C26H33ClN4O4 |
| Molecular Weight | 501.03 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 3-[4-(4-chlorophenyl)piperidin-1-yl]-1-[4-(3-methoxy-4-nitroanilino)piperidin-1-yl]propan-1-one |
| SMILES | COc1cc(NC2CCN(C(=O)CCN3CCC(c4ccc(Cl)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H33ClN4O4/c1-35-25-18-23(6-7-24(25)31(33)34)28-22-10-16-30(17-11-22)26(32)12-15-29-13-8-20(9-14-29)19-2-4-21(27)5-3-19/h2-7,18,20,22,28H,8-17H2,1H3 |
| InChIKey | YLJBIUSHJVSALM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.03 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|