C33H41N5O4 — CID 163612558
1-[4-(3-ethenoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(3-ethenylpenta-1,4-dien-3-yl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 163612558) has the molecular formula C33H41N5O4 and a molecular weight of 571.72 g/mol. Its IUPAC name is 1-[4-(3-ethenoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(3-ethenylpenta-1,4-dien-3-yl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-(3-ethenoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(3-ethenylpenta-1,4-dien-3-yl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 163612558 |
| Molecular Formula | C33H41N5O4 |
| Molecular Weight | 571.72 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 1-[4-(3-ethenoxy-4-nitroanilino)piperidin-1-yl]-3-[4-[4-(3-ethenylpenta-1,4-dien-3-yl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | C=COc1cc(NC2CCN(C(=O)CCN3CCN(c4ccc(C(C=C)(C=C)C=C)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H41N5O4/c1-5-33(6-2,7-3)26-9-12-29(13-10-26)36-23-21-35(22-24-36)18-17-32(39)37-19-15-27(16-20-37)34-28-11-14-30(38(40)41)31(25-28)42-8-4/h5-14,25,27,34H,1-4,15-24H2 |
| InChIKey | HHEUDQKCVCYNGD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.72 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|