C33H51N5O4 — CID 158539357
3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane (PubChem CID 158539357) has the molecular formula C33H51N5O4 and a molecular weight of 581.80 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane.
| Compound Name | 3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane |
|---|---|
| PubChem CID | 158539357 |
| Molecular Formula | C33H51N5O4 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.39 |
| IUPAC Name | 3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitroanilino]piperidin-1-yl]propan-1-one;methane |
| SMILES | C.CC(C)COc1cc(NC2CCN(C(=O)CCN3CCN(c4ccc(C(C)(C)C)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H47N5O4.CH4/c1-24(2)23-41-30-22-27(8-11-29(30)37(39)40)33-26-12-16-36(17-13-26)31(38)14-15-34-18-20-35(21-19-34)28-9-6-25(7-10-28)32(3,4)5;/h6-11,22,24,26,33H,12-21,23H2,1-5H3;1H4 |
| InChIKey | HOIFJQDJTYFVFT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|