C28H37ClN4O5 — CID 58576631
3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one (PubChem CID 58576631) has the molecular formula C28H37ClN4O5 and a molecular weight of 545.08 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576631 |
| Molecular Formula | C28H37ClN4O5 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | 3-[4-(4-chlorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)COc1cc(OC2CCN(C(=O)CCN3CCN(c4ccc(Cl)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H37ClN4O5/c1-21(2)20-37-27-19-25(7-8-26(27)33(35)36)38-24-9-13-32(14-10-24)28(34)11-12-30-15-17-31(18-16-30)23-5-3-22(29)4-6-23/h3-8,19,21,24H,9-18,20H2,1-2H3 |
| InChIKey | DVHYTCBKMGUXLC-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|