C25H30F2N4O5 — CID 58576339
3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one (PubChem CID 58576339) has the molecular formula C25H30F2N4O5 and a molecular weight of 504.53 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576339 |
| Molecular Formula | C25H30F2N4O5 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one |
| SMILES | COc1cc(OC2CCN(C(=O)CCN3CCN(c4ccc(F)cc4F)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H30F2N4O5/c1-35-24-17-20(3-5-23(24)31(33)34)36-19-6-10-30(11-7-19)25(32)8-9-28-12-14-29(15-13-28)22-4-2-18(26)16-21(22)27/h2-5,16-17,19H,6-15H2,1H3 |
| InChIKey | MGUJPFBGCCODNQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|