C28H36F2N4O5 — CID 58576032
3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one (PubChem CID 58576032) has the molecular formula C28H36F2N4O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576032 |
| Molecular Formula | C28H36F2N4O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-[3-(2-methylpropoxy)-4-nitrophenoxy]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)COc1cc(OC2CCN(C(=O)CCN3CCN(c4ccc(F)cc4F)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H36F2N4O5/c1-20(2)19-38-27-18-23(4-6-26(27)34(36)37)39-22-7-11-33(12-8-22)28(35)9-10-31-13-15-32(16-14-31)25-5-3-21(29)17-24(25)30/h3-6,17-18,20,22H,7-16,19H2,1-2H3 |
| InChIKey | WNRAKABQLDUURF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|