C26H33F2N5O4 — CID 58576228
3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one (PubChem CID 58576228) has the molecular formula C26H33F2N5O4 and a molecular weight of 517.58 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576228 |
| Molecular Formula | C26H33F2N5O4 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | 3-[4-(2,4-difluorophenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitroanilino)piperidin-1-yl]propan-1-one |
| SMILES | CCOc1cc(NC2CCN(C(=O)CCN3CCN(c4ccc(F)cc4F)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H33F2N5O4/c1-2-37-25-18-21(4-6-24(25)33(35)36)29-20-7-11-32(12-8-20)26(34)9-10-30-13-15-31(16-14-30)23-5-3-19(27)17-22(23)28/h3-6,17-18,20,29H,2,7-16H2,1H3 |
| InChIKey | INZUBJHRCGDBKS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|