C23H38N4O4 — CID 4966424
2-(2,5-diethoxy-4-morpholin-4-ylanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one (PubChem CID 4966424) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-(2,5-diethoxy-4-morpholin-4-ylanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-(2,5-diethoxy-4-morpholin-4-ylanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 4966424 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-(2,5-diethoxy-4-morpholin-4-ylanilino)-1-(4-ethylpiperazin-1-yl)propan-1-one |
| SMILES | CCOc1cc(N2CCOCC2)c(OCC)cc1NC(C)C(=O)N1CCN(CC)CC1 |
| InChI | InChI=1S/C23H38N4O4/c1-5-25-8-10-27(11-9-25)23(28)18(4)24-19-16-22(31-7-3)20(17-21(19)30-6-2)26-12-14-29-15-13-26/h16-18,24H,5-15H2,1-4H3 |
| InChIKey | MHWPGOMUXOUQNJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|