C26H31F3N4O5 — CID 70645022
1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one (PubChem CID 70645022) has the molecular formula C26H31F3N4O5 and a molecular weight of 536.55 g/mol. Its IUPAC name is 1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 70645022 |
| Molecular Formula | C26H31F3N4O5 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 1-[4-(3-methoxy-4-nitrophenoxy)piperidin-1-yl]-3-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-one |
| SMILES | COc1cc(OC2CCN(C(=O)CCN3CCN(c4ccc(C(F)(F)F)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H31F3N4O5/c1-37-24-18-22(6-7-23(24)33(35)36)38-21-8-12-32(13-9-21)25(34)10-11-30-14-16-31(17-15-30)20-4-2-19(3-5-20)26(27,28)29/h2-7,18,21H,8-17H2,1H3 |
| InChIKey | ZZFDWYZSJGAAKI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 88.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|