C29H42N4O7 — CID 161429343
3-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one;methane (PubChem CID 161429343) has the molecular formula C29H42N4O7 and a molecular weight of 558.68 g/mol. Its IUPAC name is 3-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one;methane.
| Compound Name | 3-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one;methane |
|---|---|
| PubChem CID | 161429343 |
| Molecular Formula | C29H42N4O7 |
| Molecular Weight | 558.68 g/mol |
| Exact Mass | 558.31 |
| IUPAC Name | 3-[4-(3,4-dimethoxyphenyl)piperazin-1-yl]-1-[4-(3-ethoxy-4-nitrophenoxy)piperidin-1-yl]propan-1-one;methane |
| SMILES | C.CCOc1cc(OC2CCN(C(=O)CCN3CCN(c4ccc(OC)c(OC)c4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H38N4O7.CH4/c1-4-38-26-20-23(6-7-24(26)32(34)35)39-22-9-13-31(14-10-22)28(33)11-12-29-15-17-30(18-16-29)21-5-8-25(36-2)27(19-21)37-3;/h5-8,19-20,22H,4,9-18H2,1-3H3;1H4 |
| InChIKey | VXUNAAVQWHAUHV-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 106.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|