C35H41F3N4O6 — CID 153039324
1-[4-(3-methoxy-4-nitrophenoxy)azepan-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,4-diazepan-1-yl]propan-1-one (PubChem CID 153039324) has the molecular formula C35H41F3N4O6 and a molecular weight of 670.73 g/mol. Its IUPAC name is 1-[4-(3-methoxy-4-nitrophenoxy)azepan-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,4-diazepan-1-yl]propan-1-one.
| Compound Name | 1-[4-(3-methoxy-4-nitrophenoxy)azepan-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,4-diazepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 153039324 |
| Molecular Formula | C35H41F3N4O6 |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 670.30 |
| IUPAC Name | 1-[4-(3-methoxy-4-nitrophenoxy)azepan-1-yl]-3-[4-[4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]-1,4-diazepan-1-yl]propan-1-one |
| SMILES | COc1cc(OC2CCCN(C(=O)CCN3CCCN(c4ccc(OCc5ccc(C(F)(F)F)cc5)cc4)CC3)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C35H41F3N4O6/c1-46-33-24-31(13-14-32(33)42(44)45)48-30-4-2-18-41(21-15-30)34(43)16-20-39-17-3-19-40(23-22-39)28-9-11-29(12-10-28)47-25-26-5-7-27(8-6-26)35(36,37)38/h5-14,24,30H,2-4,15-23,25H2,1H3 |
| InChIKey | VFJCYTFVVDPQLJ-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 97.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|