C26H30F4N4O4 — CID 58577099
4-[4-(4-fluorophenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]butan-1-one (PubChem CID 58577099) has the molecular formula C26H30F4N4O4 and a molecular weight of 538.54 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[4-(4-fluorophenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58577099 |
| Molecular Formula | C26H30F4N4O4 |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 4-[4-(4-fluorophenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)phenoxy]piperidin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(c2ccc(F)cc2)CC1)N1CCC(Oc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H30F4N4O4/c27-19-3-5-20(6-4-19)32-16-14-31(15-17-32)11-1-2-25(35)33-12-9-21(10-13-33)38-22-7-8-24(34(36)37)23(18-22)26(28,29)30/h3-8,18,21H,1-2,9-17H2 |
| InChIKey | CSHQGGXOAXYSTG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|