C27H34F3N5O3 — CID 58576438
4-[4-(3-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]butan-1-one (PubChem CID 58576438) has the molecular formula C27H34F3N5O3 and a molecular weight of 533.60 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58576438 |
| Molecular Formula | C27H34F3N5O3 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]butan-1-one |
| SMILES | Cc1cccc(N2CCN(CCCC(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)c1 |
| InChI | InChI=1S/C27H34F3N5O3/c1-20-4-2-5-23(18-20)33-16-14-32(15-17-33)11-3-6-26(36)34-12-9-21(10-13-34)31-22-7-8-25(35(37)38)24(19-22)27(28,29)30/h2,4-5,7-8,18-19,21,31H,3,6,9-17H2,1H3 |
| InChIKey | XJAQDCSDZDVQRF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|