C25H28F6N6O3 — CID 88872729
1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one (PubChem CID 88872729) has the molecular formula C25H28F6N6O3 and a molecular weight of 574.53 g/mol. Its IUPAC name is 1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 88872729 |
| Molecular Formula | C25H28F6N6O3 |
| Molecular Weight | 574.53 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | 1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]-4-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCN1CCN(c2ccc(C(F)(F)F)cn2)CC1)N1CC[C@@H](Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H28F6N6O3/c26-24(27,28)17-3-6-22(32-15-17)35-12-10-34(11-13-35)8-1-2-23(38)36-9-7-19(16-36)33-18-4-5-21(37(39)40)20(14-18)25(29,30)31/h3-6,14-15,19,33H,1-2,7-13,16H2/t19-/m1/s1 |
| InChIKey | OXJJUEGQRWDTOS-LJQANCHMSA-N |
| XLogP | 4.64 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|