C25H31F3N6O3 — CID 58576159
4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one (PubChem CID 58576159) has the molecular formula C25H31F3N6O3 and a molecular weight of 520.56 g/mol. Its IUPAC name is 4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 58576159 |
| Molecular Formula | C25H31F3N6O3 |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 4-[4-(5-methyl-2-pyridinyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]butan-1-one |
| SMILES | Cc1ccc(N2CCN(CCCC(=O)N3CC[C@@H](Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)C3)CC2)nc1 |
| InChI | InChI=1S/C25H31F3N6O3/c1-18-4-7-23(29-16-18)32-13-11-31(12-14-32)9-2-3-24(35)33-10-8-20(17-33)30-19-5-6-22(34(36)37)21(15-19)25(26,27)28/h4-7,15-16,20,30H,2-3,8-14,17H2,1H3/t20-/m1/s1 |
| InChIKey | KFTHODFXRPYWFI-HXUWFJFHSA-N |
| XLogP | 3.93 |
| TPSA | 94.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|