C26H32F3N5O3 — CID 58577224
2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one (PubChem CID 58577224) has the molecular formula C26H32F3N5O3 and a molecular weight of 519.57 g/mol. Its IUPAC name is 2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58577224 |
| Molecular Formula | C26H32F3N5O3 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | 2-methyl-3-[4-(4-methylphenyl)piperazin-1-yl]-1-[(3R)-3-[4-nitro-3-(trifluoromethyl)anilino]pyrrolidin-1-yl]propan-1-one |
| SMILES | Cc1ccc(N2CCN(CC(C)C(=O)N3CC[C@@H](Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)C3)CC2)cc1 |
| InChI | InChI=1S/C26H32F3N5O3/c1-18-3-6-22(7-4-18)32-13-11-31(12-14-32)16-19(2)25(35)33-10-9-21(17-33)30-20-5-8-24(34(36)37)23(15-20)26(27,28)29/h3-8,15,19,21,30H,9-14,16-17H2,1-2H3/t19?,21-/m1/s1 |
| InChIKey | SDHIFGOAPVXOHX-VGAJERRHSA-N |
| XLogP | 4.39 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|