C30H40F3N5O3 — CID 58118312
4-(4-tert-butylphenyl)-N-methyl-N-[[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]methyl]piperazine-1-carboxamide (PubChem CID 58118312) has the molecular formula C30H40F3N5O3 and a molecular weight of 575.68 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-N-methyl-N-[[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-(4-tert-butylphenyl)-N-methyl-N-[[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 58118312 |
| Molecular Formula | C30H40F3N5O3 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 4-(4-tert-butylphenyl)-N-methyl-N-[[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]methyl]piperazine-1-carboxamide |
| SMILES | CN(CC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)C(=O)N1CCN(c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C30H40F3N5O3/c1-29(2,3)22-7-12-25(13-8-22)36-15-17-37(18-16-36)28(39)35(4)20-21-5-9-23(10-6-21)34-24-11-14-27(38(40)41)26(19-24)30(31,32)33/h7-8,11-14,19,21,23,34H,5-6,9-10,15-18,20H2,1-4H3 |
| InChIKey | HVPNYCNKKCRHHS-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|