C27H42F3N5O3 — CID 162261798
N-[(1-cyclohexylpiperidin-4-yl)methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide;methane (PubChem CID 162261798) has the molecular formula C27H42F3N5O3 and a molecular weight of 541.66 g/mol. Its IUPAC name is N-[(1-cyclohexylpiperidin-4-yl)methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide;methane.
| Compound Name | N-[(1-cyclohexylpiperidin-4-yl)methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide;methane |
|---|---|
| PubChem CID | 162261798 |
| Molecular Formula | C27H42F3N5O3 |
| Molecular Weight | 541.66 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | N-[(1-cyclohexylpiperidin-4-yl)methyl]-N-methyl-4-[4-nitro-3-(trifluoromethyl)anilino]piperidine-1-carboxamide;methane |
| SMILES | C.CN(CC1CCN(C2CCCCC2)CC1)C(=O)N1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H38F3N5O3.CH4/c1-31(18-19-9-13-32(14-10-19)22-5-3-2-4-6-22)25(35)33-15-11-20(12-16-33)30-21-7-8-24(34(36)37)23(17-21)26(27,28)29;/h7-8,17,19-20,22,30H,2-6,9-16,18H2,1H3;1H4 |
| InChIKey | ZZISYCNFZDMWFV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.66 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|