C30H36F3N5O4 — CID 58576359
[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-[(1S,3R)-3-(4-phenylpiperazine-1-carbonyl)cyclohexyl]methanone (PubChem CID 58576359) has the molecular formula C30H36F3N5O4 and a molecular weight of 587.64 g/mol. Its IUPAC name is [4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-[(1S,3R)-3-(4-phenylpiperazine-1-carbonyl)cyclohexyl]methanone.
| Compound Name | [4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-[(1S,3R)-3-(4-phenylpiperazine-1-carbonyl)cyclohexyl]methanone |
|---|---|
| PubChem CID | 58576359 |
| Molecular Formula | C30H36F3N5O4 |
| Molecular Weight | 587.64 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | [4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-[(1S,3R)-3-(4-phenylpiperazine-1-carbonyl)cyclohexyl]methanone |
| SMILES | O=C([C@@H]1CCC[C@H](C(=O)N2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)C1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36F3N5O4/c31-30(32,33)26-20-24(9-10-27(26)38(41)42)34-23-11-13-36(14-12-23)28(39)21-5-4-6-22(19-21)29(40)37-17-15-35(16-18-37)25-7-2-1-3-8-25/h1-3,7-10,20-23,34H,4-6,11-19H2/t21-,22+/m0/s1 |
| InChIKey | FIPJPUFGVXRLBM-FCHUYYIVSA-N |
| XLogP | 5.17 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.64 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|