C23H26F3N5O5 — CID 122423623
4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 122423623) has the molecular formula C23H26F3N5O5 and a molecular weight of 509.49 g/mol. Its IUPAC name is 4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 122423623 |
| Molecular Formula | C23H26F3N5O5 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2cccc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)n2)CC1 |
| InChI | InChI=1S/C23H26F3N5O5/c24-23(25,26)18-14-16(6-9-19(18)31(34)35)27-15-4-7-17(8-5-15)36-21-3-1-2-20(28-21)29-10-12-30(13-11-29)22(32)33/h1-3,6,9,14-15,17,27H,4-5,7-8,10-13H2,(H,32,33) |
| InChIKey | CXLHTKSUCLQKKC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 121.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|