C29H36F3N5O4 — CID 122423614
2-cyclopentyl-1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-4-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 122423614) has the molecular formula C29H36F3N5O4 and a molecular weight of 575.63 g/mol. Its IUPAC name is 2-cyclopentyl-1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-4-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 2-cyclopentyl-1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-4-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122423614 |
| Molecular Formula | C29H36F3N5O4 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | 2-cyclopentyl-1-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-4-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CC1CCCC1)N1CCN(c2ccnc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)c2)CC1 |
| InChI | InChI=1S/C29H36F3N5O4/c30-29(31,32)25-18-22(7-10-26(25)37(39)40)34-21-5-8-24(9-6-21)41-27-19-23(11-12-33-27)35-13-15-36(16-14-35)28(38)17-20-3-1-2-4-20/h7,10-12,18-21,24,34H,1-6,8-9,13-17H2 |
| InChIKey | SLACVUBUEMAINF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|