C24H28F3N5O5 — CID 134166858
methyl 4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 134166858) has the molecular formula C24H28F3N5O5 and a molecular weight of 523.51 g/mol. Its IUPAC name is methyl 4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | methyl 4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 134166858 |
| Molecular Formula | C24H28F3N5O5 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.20 |
| IUPAC Name | methyl 4-[4-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2cc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C24H28F3N5O5/c1-36-23(33)31-12-10-30(11-13-31)22-15-19(8-9-28-22)37-18-5-2-16(3-6-18)29-17-4-7-21(32(34)35)20(14-17)24(25,26)27/h4,7-9,14-16,18,29H,2-3,5-6,10-13H2,1H3 |
| InChIKey | ODBWHZQYSCVRRL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|