C25H32F3N5O3 — CID 134166861
4-nitro-N-[4-[[2-(4-propylpiperazin-1-yl)-4-pyridinyl]oxy]cyclohexyl]-3-(trifluoromethyl)aniline (PubChem CID 134166861) has the molecular formula C25H32F3N5O3 and a molecular weight of 507.56 g/mol. Its IUPAC name is 4-nitro-N-[4-[[2-(4-propylpiperazin-1-yl)-4-pyridinyl]oxy]cyclohexyl]-3-(trifluoromethyl)aniline.
| Compound Name | 4-nitro-N-[4-[[2-(4-propylpiperazin-1-yl)-4-pyridinyl]oxy]cyclohexyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134166861 |
| Molecular Formula | C25H32F3N5O3 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 4-nitro-N-[4-[[2-(4-propylpiperazin-1-yl)-4-pyridinyl]oxy]cyclohexyl]-3-(trifluoromethyl)aniline |
| SMILES | CCCN1CCN(c2cc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)ccn2)CC1 |
| InChI | InChI=1S/C25H32F3N5O3/c1-2-11-31-12-14-32(15-13-31)24-17-21(9-10-29-24)36-20-6-3-18(4-7-20)30-19-5-8-23(33(34)35)22(16-19)25(26,27)28/h5,8-10,16-18,20,30H,2-4,6-7,11-15H2,1H3 |
| InChIKey | MXVQLIAJLASFSM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|