C25H31F3N6O3S — CID 134166894
N-ethyl-4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazine-1-carbothioamide (PubChem CID 134166894) has the molecular formula C25H31F3N6O3S and a molecular weight of 552.62 g/mol. Its IUPAC name is N-ethyl-4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazine-1-carbothioamide.
| Compound Name | N-ethyl-4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 134166894 |
| Molecular Formula | C25H31F3N6O3S |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | N-ethyl-4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazine-1-carbothioamide |
| SMILES | CCNC(=S)N1CCN(c2cncc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)c2)CC1 |
| InChI | InChI=1S/C25H31F3N6O3S/c1-2-30-24(38)33-11-9-32(10-12-33)19-14-21(16-29-15-19)37-20-6-3-17(4-7-20)31-18-5-8-23(34(35)36)22(13-18)25(26,27)28/h5,8,13-17,20,31H,2-4,6-7,9-12H2,1H3,(H,30,38) |
| InChIKey | LJUSGNQYVCLYDC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 95.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|