C27H36F3N5O3 — CID 134166842
N-[4-[[5-[4-(2,2-dimethylpropyl)piperazin-1-yl]-3-pyridinyl]oxy]cyclohexyl]-4-nitro-3-(trifluoromethyl)aniline (PubChem CID 134166842) has the molecular formula C27H36F3N5O3 and a molecular weight of 535.61 g/mol. Its IUPAC name is N-[4-[[5-[4-(2,2-dimethylpropyl)piperazin-1-yl]-3-pyridinyl]oxy]cyclohexyl]-4-nitro-3-(trifluoromethyl)aniline.
| Compound Name | N-[4-[[5-[4-(2,2-dimethylpropyl)piperazin-1-yl]-3-pyridinyl]oxy]cyclohexyl]-4-nitro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 134166842 |
| Molecular Formula | C27H36F3N5O3 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | N-[4-[[5-[4-(2,2-dimethylpropyl)piperazin-1-yl]-3-pyridinyl]oxy]cyclohexyl]-4-nitro-3-(trifluoromethyl)aniline |
| SMILES | CC(C)(C)CN1CCN(c2cncc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)c2)CC1 |
| InChI | InChI=1S/C27H36F3N5O3/c1-26(2,3)18-33-10-12-34(13-11-33)21-15-23(17-31-16-21)38-22-7-4-19(5-8-22)32-20-6-9-25(35(36)37)24(14-20)27(28,29)30/h6,9,14-17,19,22,32H,4-5,7-8,10-13,18H2,1-3H3 |
| InChIKey | FUEJNNIYKYDJBS-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|