C28H36F3N5O4 — CID 134166902
3,3-dimethyl-1-[4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]butan-1-one (PubChem CID 134166902) has the molecular formula C28H36F3N5O4 and a molecular weight of 563.62 g/mol. Its IUPAC name is 3,3-dimethyl-1-[4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]butan-1-one.
| Compound Name | 3,3-dimethyl-1-[4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 134166902 |
| Molecular Formula | C28H36F3N5O4 |
| Molecular Weight | 563.62 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | 3,3-dimethyl-1-[4-[6-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-2-pyridinyl]piperazin-1-yl]butan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCN(c2cccc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)n2)CC1 |
| InChI | InChI=1S/C28H36F3N5O4/c1-27(2,3)18-26(37)35-15-13-34(14-16-35)24-5-4-6-25(33-24)40-21-10-7-19(8-11-21)32-20-9-12-23(36(38)39)22(17-20)28(29,30)31/h4-6,9,12,17,19,21,32H,7-8,10-11,13-16,18H2,1-3H3 |
| InChIKey | SUSYWDSGDFODLC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|