C29H31F4N5O4 — CID 90149825
1-[4-(6-fluoro-4-methylquinolin-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90149825) has the molecular formula C29H31F4N5O4 and a molecular weight of 589.59 g/mol. Its IUPAC name is 1-[4-(6-fluoro-4-methylquinolin-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-(6-fluoro-4-methylquinolin-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90149825 |
| Molecular Formula | C29H31F4N5O4 |
| Molecular Weight | 589.59 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | 1-[4-(6-fluoro-4-methylquinolin-2-yl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | Cc1cc(N2CCN(C(=O)COC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)nc2ccc(F)cc12 |
| InChI | InChI=1S/C29H31F4N5O4/c1-18-14-27(35-25-8-2-19(30)15-23(18)25)36-10-12-37(13-11-36)28(39)17-42-22-6-3-20(4-7-22)34-21-5-9-26(38(40)41)24(16-21)29(31,32)33/h2,5,8-9,14-16,20,22,34H,3-4,6-7,10-13,17H2,1H3 |
| InChIKey | FLIOZLGESSISFJ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|