C27H29F6N3O6 — CID 118654042
2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]ethanone (PubChem CID 118654042) has the molecular formula C27H29F6N3O6 and a molecular weight of 605.53 g/mol. Its IUPAC name is 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118654042 |
| Molecular Formula | C27H29F6N3O6 |
| Molecular Weight | 605.53 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C27H29F6N3O6/c28-26(29,30)23-15-18(3-10-24(23)36(38)39)34-17-1-4-19(5-2-17)40-16-25(37)35-13-11-21(12-14-35)41-20-6-8-22(9-7-20)42-27(31,32)33/h3,6-10,15,17,19,21,34H,1-2,4-5,11-14,16H2 |
| InChIKey | DHKVCSGNOAEJQW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|