C29H30F6N4O5 — CID 90149986
2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 90149986) has the molecular formula C29H30F6N4O5 and a molecular weight of 628.57 g/mol. Its IUPAC name is 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 90149986 |
| Molecular Formula | C29H30F6N4O5 |
| Molecular Weight | 628.57 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(Cc2cc3cc(C(F)(F)F)ccc3o2)CC1 |
| InChI | InChI=1S/C29H30F6N4O5/c30-28(31,32)19-1-8-26-18(13-19)14-23(44-26)16-37-9-11-38(12-10-37)27(40)17-43-22-5-2-20(3-6-22)36-21-4-7-25(39(41)42)24(15-21)29(33,34)35/h1,4,7-8,13-15,20,22,36H,2-3,5-6,9-12,16-17H2 |
| InChIKey | QIZFHKCYOXXXEV-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.57 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|