C28H29F6N5O4S2 — CID 135128449
2-[4-[[4-nitro-3-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]piperazin-1-yl]ethanone (PubChem CID 135128449) has the molecular formula C28H29F6N5O4S2 and a molecular weight of 677.69 g/mol. Its IUPAC name is 2-[4-[[4-nitro-3-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[4-[[4-nitro-3-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 135128449 |
| Molecular Formula | C28H29F6N5O4S2 |
| Molecular Weight | 677.69 g/mol |
| Exact Mass | 677.16 |
| IUPAC Name | 2-[4-[[4-nitro-3-(trifluoromethyl)phenyl]sulfanylamino]cyclohexyl]oxy-1-[4-[[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl]piperazin-1-yl]ethanone |
| SMILES | O=C(COC1CCC(NSc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(Cc2nc3cc(C(F)(F)F)ccc3s2)CC1 |
| InChI | InChI=1S/C28H29F6N5O4S2/c29-27(30,31)17-1-8-24-22(13-17)35-25(44-24)15-37-9-11-38(12-10-37)26(40)16-43-19-4-2-18(3-5-19)36-45-20-6-7-23(39(41)42)21(14-20)28(32,33)34/h1,6-8,13-14,18-19,36H,2-5,9-12,15-16H2 |
| InChIKey | OAYMNKOXAGUJBK-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.69 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|