C27H31F4N5O4S — CID 144632760
N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;1-[4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]piperazin-1-yl]-2-hydroxyethanone (PubChem CID 144632760) has the molecular formula C27H31F4N5O4S and a molecular weight of 597.64 g/mol. Its IUPAC name is N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;1-[4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]piperazin-1-yl]-2-hydroxyethanone.
| Compound Name | N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;1-[4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]piperazin-1-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 144632760 |
| Molecular Formula | C27H31F4N5O4S |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;1-[4-[(5-fluoro-1,3-benzothiazol-2-yl)methyl]piperazin-1-yl]-2-hydroxyethanone |
| SMILES | O=C(CO)N1CCN(Cc2nc3cc(F)ccc3s2)CC1.O=[N+]([O-])c1ccc(NC2CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16FN3O2S.C13H15F3N2O2/c15-10-1-2-12-11(7-10)16-13(21-12)8-17-3-5-18(6-4-17)14(20)9-19;14-13(15,16)11-8-10(6-7-12(11)18(19)20)17-9-4-2-1-3-5-9/h1-2,7,19H,3-6,8-9H2;6-9,17H,1-5H2 |
| InChIKey | IENPKSXKOAQHRA-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 111.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|