C27H29F4N5O5 — CID 90149821
1-[4-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 90149821) has the molecular formula C27H29F4N5O5 and a molecular weight of 579.55 g/mol. Its IUPAC name is 1-[4-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 90149821 |
| Molecular Formula | C27H29F4N5O5 |
| Molecular Weight | 579.55 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | 1-[4-[(5-fluoro-1,3-benzoxazol-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(Cc2nc3cc(F)ccc3o2)CC1 |
| InChI | InChI=1S/C27H29F4N5O5/c28-17-1-8-24-22(13-17)33-25(41-24)15-34-9-11-35(12-10-34)26(37)16-40-20-5-2-18(3-6-20)32-19-4-7-23(36(38)39)21(14-19)27(29,30)31/h1,4,7-8,13-14,18,20,32H,2-3,5-6,9-12,15-16H2 |
| InChIKey | VVQWWPZCBJJERL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|