C28H32ClF3N4O5 — CID 86719478
1-[4-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone (PubChem CID 86719478) has the molecular formula C28H32ClF3N4O5 and a molecular weight of 597.03 g/mol. Its IUPAC name is 1-[4-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone.
| Compound Name | 1-[4-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
|---|---|
| PubChem CID | 86719478 |
| Molecular Formula | C28H32ClF3N4O5 |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.20 |
| IUPAC Name | 1-[4-[(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methyl]piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(CC2Cc3cc(Cl)ccc3O2)CC1 |
| InChI | InChI=1S/C28H32ClF3N4O5/c29-19-1-8-26-18(13-19)14-23(41-26)16-34-9-11-35(12-10-34)27(37)17-40-22-5-2-20(3-6-22)33-21-4-7-25(36(38)39)24(15-21)28(30,31)32/h1,4,7-8,13,15,20,22-23,33H,2-3,5-6,9-12,14,16-17H2 |
| InChIKey | HGBGMKQFVBLTAK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|