C28H33F3N4O5 — CID 90176562
2-[4-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetaldehyde (PubChem CID 90176562) has the molecular formula C28H33F3N4O5 and a molecular weight of 562.59 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetaldehyde.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetaldehyde |
|---|---|
| PubChem CID | 90176562 |
| Molecular Formula | C28H33F3N4O5 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-2-ylmethyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetaldehyde |
| SMILES | O=CC(OC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)N1CCN(CC2Cc3ccccc3O2)CC1 |
| InChI | InChI=1S/C28H33F3N4O5/c29-28(30,31)24-16-21(7-10-25(24)35(37)38)32-20-5-8-22(9-6-20)40-27(18-36)34-13-11-33(12-14-34)17-23-15-19-3-1-2-4-26(19)39-23/h1-4,7,10,16,18,20,22-23,27,32H,5-6,8-9,11-15,17H2 |
| InChIKey | KOMJLHJUMFMCMZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|