C17H22F3N3O4 — CID 174841364
[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174841364) has the molecular formula C17H22F3N3O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is [4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174841364 |
| Molecular Formula | C17H22F3N3O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H22F3N3O4/c1-16(2,3)15(24)27-22-8-6-11(7-9-22)21-12-4-5-14(23(25)26)13(10-12)17(18,19)20/h4-5,10-11,21H,6-9H2,1-3H3 |
| InChIKey | SXARFDADBRIIHW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|