C12H14F3N3O2 — CID 63319110
N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-3-amine (PubChem CID 63319110) has the molecular formula C12H14F3N3O2 and a molecular weight of 289.26 g/mol. Its IUPAC name is N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-3-amine.
| Compound Name | N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-3-amine |
|---|---|
| PubChem CID | 63319110 |
| Molecular Formula | C12H14F3N3O2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[4-nitro-3-(trifluoromethyl)phenyl]piperidin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(NC2CCCNC2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O2/c13-12(14,15)10-6-8(3-4-11(10)18(19)20)17-9-2-1-5-16-7-9/h3-4,6,9,16-17H,1-2,5,7H2 |
| InChIKey | GXDLREPEBJFKNS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|