C28H35F3N4O3S — CID 58118171
2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxypropane-1-thione (PubChem CID 58118171) has the molecular formula C28H35F3N4O3S and a molecular weight of 564.67 g/mol. Its IUPAC name is 2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxypropane-1-thione.
| Compound Name | 2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxypropane-1-thione |
|---|---|
| PubChem CID | 58118171 |
| Molecular Formula | C28H35F3N4O3S |
| Molecular Weight | 564.67 g/mol |
| Exact Mass | 564.24 |
| IUPAC Name | 2-methyl-1-[4-(4-methylphenyl)piperazin-1-yl]-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxypropane-1-thione |
| SMILES | Cc1ccc(N2CCN(C(=S)C(C)(C)OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H35F3N4O3S/c1-19-4-9-22(10-5-19)33-14-16-34(17-15-33)26(39)27(2,3)38-23-11-6-20(7-12-23)32-21-8-13-25(35(36)37)24(18-21)28(29,30)31/h4-5,8-10,13,18,20,23,32H,6-7,11-12,14-17H2,1-3H3 |
| InChIKey | LAOLERUVKLORID-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.67 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|