C29H30F6N6O3 — CID 73295788
N-[4-[5-methyl-6-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]oxycyclohexyl]-4-nitro-3-(trifluoromethyl)aniline (PubChem CID 73295788) has the molecular formula C29H30F6N6O3 and a molecular weight of 624.59 g/mol. Its IUPAC name is N-[4-[5-methyl-6-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]oxycyclohexyl]-4-nitro-3-(trifluoromethyl)aniline.
| Compound Name | N-[4-[5-methyl-6-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]oxycyclohexyl]-4-nitro-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 73295788 |
| Molecular Formula | C29H30F6N6O3 |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | N-[4-[5-methyl-6-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]pyrimidin-4-yl]oxycyclohexyl]-4-nitro-3-(trifluoromethyl)aniline |
| SMILES | Cc1c(OC2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)ncnc1N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C29H30F6N6O3/c1-18-26(40-14-12-39(13-15-40)22-7-2-19(3-8-22)28(30,31)32)36-17-37-27(18)44-23-9-4-20(5-10-23)38-21-6-11-25(41(42)43)24(16-21)29(33,34)35/h2-3,6-8,11,16-17,20,23,38H,4-5,9-10,12-15H2,1H3 |
| InChIKey | LBZZGIJFJNYETN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|