C24H25F6N5O4 — CID 134166961
2,2,2-trifluoro-1-[4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazin-1-yl]ethanone (PubChem CID 134166961) has the molecular formula C24H25F6N5O4 and a molecular weight of 561.48 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 134166961 |
| Molecular Formula | C24H25F6N5O4 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[5-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxy-3-pyridinyl]piperazin-1-yl]ethanone |
| SMILES | O=C(N1CCN(c2cncc(OC3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)c2)CC1)C(F)(F)F |
| InChI | InChI=1S/C24H25F6N5O4/c25-23(26,27)20-11-16(3-6-21(20)35(37)38)32-15-1-4-18(5-2-15)39-19-12-17(13-31-14-19)33-7-9-34(10-8-33)22(36)24(28,29)30/h3,6,11-15,18,32H,1-2,4-5,7-10H2 |
| InChIKey | GKACRNIMIJWLSE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|