C30H32F6N6O4 — CID 145126839
N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;4-(5-hydroxy-3-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 145126839) has the molecular formula C30H32F6N6O4 and a molecular weight of 654.61 g/mol. Its IUPAC name is N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;4-(5-hydroxy-3-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;4-(5-hydroxy-3-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 145126839 |
| Molecular Formula | C30H32F6N6O4 |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | N-cyclohexyl-4-nitro-3-(trifluoromethyl)aniline;4-(5-hydroxy-3-pyridinyl)-N-[4-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCN(c2cncc(O)c2)CC1.O=[N+]([O-])c1ccc(NC2CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H17F3N4O2.C13H15F3N2O2/c18-17(19,20)12-1-3-13(4-2-12)22-16(26)24-7-5-23(6-8-24)14-9-15(25)11-21-10-14;14-13(15,16)11-8-10(6-7-12(11)18(19)20)17-9-4-2-1-3-5-9/h1-4,9-11,25H,5-8H2,(H,22,26);6-9,17H,1-5H2 |
| InChIKey | QCHUTCMCFJISDC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|