C30H40F3N5O3 — CID 58577188
3-[4-(4-tert-butylphenyl)-1,4-diazepan-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one (PubChem CID 58577188) has the molecular formula C30H40F3N5O3 and a molecular weight of 575.68 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenyl)-1,4-diazepan-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(4-tert-butylphenyl)-1,4-diazepan-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58577188 |
| Molecular Formula | C30H40F3N5O3 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.31 |
| IUPAC Name | 3-[4-(4-tert-butylphenyl)-1,4-diazepan-1-yl]-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)(C)c1ccc(N2CCCN(CCC(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H40F3N5O3/c1-29(2,3)22-5-8-25(9-6-22)36-15-4-14-35(19-20-36)16-13-28(39)37-17-11-23(12-18-37)34-24-7-10-27(38(40)41)26(21-24)30(31,32)33/h5-10,21,23,34H,4,11-20H2,1-3H3 |
| InChIKey | SLABZSDTSDKGET-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 81.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|