C30H42F3N5O — CID 144994247
1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-(4-tert-butylphenyl)piperazin-1-yl]butan-1-one (PubChem CID 144994247) has the molecular formula C30H42F3N5O and a molecular weight of 545.69 g/mol. Its IUPAC name is 1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-(4-tert-butylphenyl)piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-(4-tert-butylphenyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 144994247 |
| Molecular Formula | C30H42F3N5O |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | 1-[4-[4-amino-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-[4-(4-tert-butylphenyl)piperazin-1-yl]butan-1-one |
| SMILES | CC(C)(C)c1ccc(N2CCN(CCCC(=O)N3CCC(Nc4ccc(N)c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C30H42F3N5O/c1-29(2,3)22-6-9-25(10-7-22)37-19-17-36(18-20-37)14-4-5-28(39)38-15-12-23(13-16-38)35-24-8-11-27(34)26(21-24)30(31,32)33/h6-11,21,23,35H,4-5,12-20,34H2,1-3H3 |
| InChIKey | CORCSQJSJMJNID-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|