C29H39F3N4O2 — CID 58576408
3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]propan-1-one (PubChem CID 58576408) has the molecular formula C29H39F3N4O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is 3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]propan-1-one.
| Compound Name | 3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576408 |
| Molecular Formula | C29H39F3N4O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 3-[4-(4-tert-butylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)(C)c1ccc(N2CCN(CCC(=O)N3CCC(Nc4ccc(OC(F)(F)F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H39F3N4O2/c1-28(2,3)22-4-8-25(9-5-22)35-20-18-34(19-21-35)15-14-27(37)36-16-12-24(13-17-36)33-23-6-10-26(11-7-23)38-29(30,31)32/h4-11,24,33H,12-21H2,1-3H3 |
| InChIKey | ARCJEOHVSYPIKZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|