C27H35F3N4OS — CID 58576390
4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]butane-1-thione (PubChem CID 58576390) has the molecular formula C27H35F3N4OS and a molecular weight of 520.67 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]butane-1-thione.
| Compound Name | 4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]butane-1-thione |
|---|---|
| PubChem CID | 58576390 |
| Molecular Formula | C27H35F3N4OS |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | 4-[4-(4-methylphenyl)piperazin-1-yl]-1-[4-[4-(trifluoromethoxy)anilino]piperidin-1-yl]butane-1-thione |
| SMILES | Cc1ccc(N2CCN(CCCC(=S)N3CCC(Nc4ccc(OC(F)(F)F)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C27H35F3N4OS/c1-21-4-8-24(9-5-21)33-19-17-32(18-20-33)14-2-3-26(36)34-15-12-23(13-16-34)31-22-6-10-25(11-7-22)35-27(28,29)30/h4-11,23,31H,2-3,12-20H2,1H3 |
| InChIKey | ONJLFQWZJDCYCT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|