C28H39N3OS — CID 130211422
1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butane-1-thione (PubChem CID 130211422) has the molecular formula C28H39N3OS and a molecular weight of 465.71 g/mol. Its IUPAC name is 1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butane-1-thione.
| Compound Name | 1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butane-1-thione |
|---|---|
| PubChem CID | 130211422 |
| Molecular Formula | C28H39N3OS |
| Molecular Weight | 465.71 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | 1-[4-(3,4-dimethylphenoxy)piperidin-1-yl]-4-[4-(4-methylphenyl)piperazin-1-yl]butane-1-thione |
| SMILES | Cc1ccc(N2CCN(CCCC(=S)N3CCC(Oc4ccc(C)c(C)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C28H39N3OS/c1-22-6-9-25(10-7-22)30-19-17-29(18-20-30)14-4-5-28(33)31-15-12-26(13-16-31)32-27-11-8-23(2)24(3)21-27/h6-11,21,26H,4-5,12-20H2,1-3H3 |
| InChIKey | KWNUQASTUCYNJN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|