C29H36N2O2 — CID 42867816
1-(3,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-3-(4-methylphenoxy)propyl]piperazine (PubChem CID 42867816) has the molecular formula C29H36N2O2 and a molecular weight of 444.62 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-3-(4-methylphenoxy)propyl]piperazine.
| Compound Name | 1-(3,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-3-(4-methylphenoxy)propyl]piperazine |
|---|---|
| PubChem CID | 42867816 |
| Molecular Formula | C29H36N2O2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-[3-(4-methoxyphenyl)-3-(4-methylphenoxy)propyl]piperazine |
| SMILES | COc1ccc(C(CCN2CCN(c3ccc(C)c(C)c3)CC2)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H36N2O2/c1-22-5-11-28(12-6-22)33-29(25-8-13-27(32-4)14-9-25)15-16-30-17-19-31(20-18-30)26-10-7-23(2)24(3)21-26/h5-14,21,29H,15-20H2,1-4H3 |
| InChIKey | RFUNUBIGXUDPRG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|