C22H29N3O4 — CID 67281832
[1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate (PubChem CID 67281832) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate.
| Compound Name | [1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate |
|---|---|
| PubChem CID | 67281832 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl] carbamate |
| SMILES | COc1ccc(C(CCN2CCN(c3ccc(OC)cc3)CC2)OC(N)=O)cc1 |
| InChI | InChI=1S/C22H29N3O4/c1-27-19-7-3-17(4-8-19)21(29-22(23)26)11-12-24-13-15-25(16-14-24)18-5-9-20(28-2)10-6-18/h3-10,21H,11-16H2,1-2H3,(H2,23,26) |
| InChIKey | BUSDSMMCOLSENE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|